![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 1.1.1 Main Building.JPG | 2018-10-05 23:24 | 15M | |
| 1.2.1swimming pool.jpg | 2021-06-23 00:15 | 3.8M | |
| 1.2.2 Exterior Villa..> | 2020-10-04 10:53 | 5.1M | |
| 1.2 Main Building.JPG | 2018-10-05 23:27 | 15M | |
| 1.3.1 swimming pool.jpg | 2021-06-23 00:15 | 4.1M | |
| 1.3 swimming pool.jpg | 2021-06-23 00:15 | 3.6M | |
| 1.4 swimming pool.jpg | 2021-06-23 00:15 | 5.4M | |
| 1.5 swimming pool.jpg | 2021-06-23 00:15 | 3.8M | |
| 1.7. swimming pool.jpg | 2021-06-23 00:15 | 2.2M | |
| 1.8 swimming pool.jpg | 2021-06-23 00:15 | 3.1M | |
| 1.9.1 relax beds.jpg | 2021-06-23 00:15 | 1.8M | |
| 1.9 relax beds.jpg | 2021-06-23 00:15 | 2.5M | |
| 2.1.2 Bigger swimmin..> | 2018-10-05 23:26 | 15M | |
| 2.1 relax zone.jpg | 2021-06-23 00:15 | 4.5M | |
| 2.3 Sea view.JPG | 2018-10-05 23:31 | 15M | |
| 2.11 Lobby.JPG | 2016-10-25 10:14 | 2.1M | |
| 2.13 Standart view.JPG | 2018-10-05 23:24 | 5.8M | |
| 2.14 Reception.JPG | 2018-10-05 23:14 | 9.1M | |
| 2.15 Reception.JPG | 2018-10-05 23:14 | 2.5M | |
| 2.16 Reception.JPG | 2018-10-05 23:14 | 3.2M | |
| 2.17 Reception.JPG | 2018-10-05 23:33 | 3.5M | |
| 2.18 Reception.JPG | 2018-10-05 23:33 | 2.5M | |
| 2.19 Housekeeper.JPG | 2018-10-05 23:34 | 3.7M | |
| 2.182 Bedroom Apartm..> | 2020-10-04 10:53 | 3.9M | |
| 2.184 Bathroom Doubl..> | 2020-10-04 10:53 | 4.9M | |
| 2.185 Bathroom Doubl..> | 2020-10-04 10:53 | 4.8M | |
| 2.187 Bathroom Doubl..> | 2020-10-04 10:53 | 3.1M | |
| 2.188. Bathroom Doub..> | 2020-10-04 10:53 | 3.7M | |
| 2.189 Double room LU..> | 2020-10-04 10:53 | 4.1M | |
| 2.193 Double room LU..> | 2020-10-04 10:53 | 4.1M | |
| 2.194 Double room LU..> | 2020-10-04 10:53 | 4.2M | |
| 2.195 Apartment.jpg | 2020-10-04 10:53 | 4.4M | |
| 2.196 Apartment.jpg | 2020-10-04 10:53 | 3.9M | |
| 2.197 Living room Ap..> | 2020-10-04 10:53 | 3.9M | |
| 2.199 Apartment.jpg | 2020-10-04 10:53 | 2.9M | |
| 2.1990 Bedroom Apart..> | 2020-10-04 10:53 | 3.5M | |
| 2.1991 Kitchen Apart..> | 2020-10-04 10:53 | 3.2M | |
| 2 relax zone.jpg | 2021-06-23 00:15 | 5.4M | |
| 3.1Double room LUX w..> | 2016-10-25 23:11 | 2.9M | |
| 3.2 Double room LUX ..> | 2018-10-05 23:12 | 2.2M | |
| 3.3 Double room LUX ..> | 2018-10-05 23:12 | 2.1M | |
| 3.4 Double room LUX ..> | 2018-10-05 23:12 | 2.9M | |
| 3.5 Bathroom Double ..> | 2018-10-05 23:12 | 9.0M | |
| 3.6 Studio with kitc..> | 2018-10-05 23:15 | 10M | |
| 3.7 Studio with kitc..> | 2018-10-05 23:15 | 3.3M | |
| 3.8 Studio with kitc..> | 2018-10-05 23:15 | 11M | |
| 3.9 Studio with kitc..> | 2018-10-05 23:15 | 9.4M | |
| 3.10 Studio with kit..> | 2018-10-05 23:15 | 3.9M | |
| 3.11 Studio with kit..> | 2018-10-05 23:16 | 3.7M | |
| 3.12. Studio with ki..> | 2021-06-23 00:15 | 3.7M | |
| 3.13 Studio with kit..> | 2021-06-23 00:15 | 7.1M | |
| 3.14. Studio with ki..> | 2021-06-23 00:15 | 3.8M | |
| 3.15. Studio with ki..> | 2021-06-23 00:15 | 3.9M | |
| 3.17 Standart room a..> | 2018-10-05 23:13 | 9.9M | |
| 3.18 Double room LUX..> | 2021-06-23 00:15 | 6.0M | |
| 3.19. Double room LU..> | 2021-06-23 00:15 | 6.0M | |
| 3.20. Double room LU..> | 2021-06-23 00:15 | 6.2M | |
| 3.21. Double room LU..> | 2021-06-23 00:15 | 3.5M | |
| 3.22. Double room LU..> | 2021-06-23 00:15 | 3.7M | |
| 3.22.Double room LUX..> | 2021-06-23 00:15 | 3.4M | |
| 3.23.Double room LUX..> | 2021-06-23 00:15 | 3.2M | |
| 3.26 Bathroom Standa..> | 2018-10-05 23:20 | 3.4M | |
| 3.27 Cosmetics.JPG | 2018-10-05 23:34 | 3.3M | |
| 3.28 Bathroom Standa..> | 2018-10-05 23:13 | 2.8M | |
| 3.29 Hat Bamboo.JPG | 2018-10-05 23:17 | 7.0M | |
| 3.30 Sea View from m..> | 2018-10-05 23:17 | 14M | |
| 3.31 Sea view from m..> | 2018-10-05 23:16 | 15M | |
| 4.1 Details Restaura..> | 2018-10-05 23:20 | 4.0M | |
| 4.2. Desing Restaura..> | 2018-10-05 23:20 | 11M | |
| 4.3 Tables Restauran..> | 2018-10-05 23:21 | 4.0M | |
| 4.4 Restaurant.JPG | 2018-10-05 23:21 | 3.9M | |
| 4.5 Restaurant.JPG | 2018-10-05 23:22 | 4.2M | |
| 4.6 Restaurant.JPG | 2018-10-05 23:22 | 4.4M | |
| 4.7 Restaurant.JPG | 2018-10-05 23:21 | 12M | |
| 4.9 Restaurant.JPG | 2018-10-05 23:21 | 12M | |
| 4.10 Restaurant.JPG | 2018-10-05 23:22 | 4.1M | |
| 4.11 Restaurant.JPG | 2018-10-05 23:22 | 4.1M | |
| 4.12 Details Restaur..> | 2018-10-05 23:21 | 12M | |
| 5.1Terrace Restauran..> | 2018-10-05 23:28 | 6.2M | |
| 5.2 Terrace Restaura..> | 2018-10-05 23:29 | 5.2M | |
| 5.3 Food and Drinks.JPG | 2018-10-05 23:29 | 3.7M | |
| 5.4 Food and Drinks.JPG | 2018-10-05 23:31 | 2.8M | |
| 5.5 Food and Drinks.JPG | 2018-10-05 23:32 | 3.8M | |
| 5.6 Food and Drinks.JPG | 2018-10-05 23:32 | 3.6M | |
| 5.7 Food and Drinks.JPG | 2018-10-05 23:32 | 3.4M | |
| 5.8 Garden Restauran..> | 2018-10-05 23:33 | 4.5M | |
| 5.13 Terrace Restaur..> | 2018-10-05 23:27 | 5.6M | |
| 7.4 Buffet.JPG | 2016-10-25 10:30 | 4.0M | |
| 7.5 Buffet.JPG | 2018-10-05 23:23 | 4.4M | |
| 7.6 Buffet.JPG | 2016-10-25 10:33 | 1.8M | |
| 7.8 Cold Buffet.JPG | 2016-10-25 10:00 | 1.8M | |
| 7.9 Hot Buffet.jpg | 2021-01-13 22:09 | 359K | |
| 7.10 Desserts.JPG | 2016-10-25 10:32 | 1.3M | |
| 8.1 Relax zone.JPG | 2018-10-05 23:33 | 4.4M | |
| 8.2 Umbrellas and su..> | 2016-10-25 10:03 | 2.4M | |
| 8.4 Kids area.JPG | 2018-10-05 23:27 | 8.1M | |
| 8.5 Kids area.JPG | 2018-10-05 23:27 | 7.4M | |
| 8.8 Sauna.JPG | 2018-10-05 23:23 | 4.1M | |
| 9.1 View Sozopol.JPG | 2017-02-01 17:48 | 3.7M | |
| 9.2 Bamboo beach.JPG | 2017-02-01 17:49 | 4.0M | |
| 9.3 Bamboo beach.JPG | 2017-02-01 17:49 | 4.0M | |
| 9.4 Bamboo Beach.jpg | 2017-02-08 22:12 | 2.8M | |
| 9.5 Bamboo beach.jpg | 2017-02-08 14:22 | 1.5M | |
| 9.7 Bamboo beach.jpg | 2017-02-08 14:21 | 1.2M | |
| 9.8 Bar bamboo beach..> | 2017-02-08 14:21 | 1.0M | |
| 9.9 Umbrella and sun..> | 2017-02-08 14:33 | 1.5M | |
| 9.10 Tent.jpg | 2017-02-08 14:22 | 1.1M | |
| 9.11 Scene for music..> | 2017-02-08 14:33 | 1.7M | |
| 9.12 Bamboo beach.jpg | 2017-02-08 14:33 | 2.9M | |
| 9.13 Bamboo Beach Re..> | 2017-02-08 14:32 | 1.6M | |
| 9.14 Bamboo Beach Re..> | 2017-02-08 14:33 | 1.1M | |
| 9.15 Bamboo Beach Re..> | 2017-02-08 14:32 | 1.3M | |
| 9.16 Bamboo Beach En..> | 2015-07-19 19:41 | 6.3M | |
| 10 Sozopol Marina.JPG | 2017-02-01 17:45 | 3.6M | |
| Family.jpg | 2022-12-20 16:05 | 3.8M | |
